CAS 89210-40-2 is the registry number for (2,4,6-Triethylphenyl)amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
2,4,6-triethylaniline;hydrochloride (CAS 89210-40-2) is a chemical compound with the molecular formula C12H20ClN and a molecular weight of 213.75 g/mol. IUPAC name: 2,4,6-triethylaniline;hydrochloride. InChIKey: KIRCIWDEVMCOKH-UHFFFAOYSA-N.
| Molecular formula | C12H20ClN |
|---|---|
| Molecular weight | 213.75 g/mol |
| IUPAC name | 2,4,6-triethylaniline;hydrochloride |
| InChIKey | KIRCIWDEVMCOKH-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=C(C(=C1)CC)N)CC.Cl |
Computed by PubChem (NCBI)