cas: 774-55-0 — see every product listed under this CAS number, including other names
1-(5,6,7,8-Tetrahydronaphthalen-2-yl)ethanone 98% (CAS 774-55-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A420919-250mg |
| cas | 774-55-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 331.44 Pln | |
| Ambeed | 25g | 932.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A420919 |
1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanone (CAS 774-55-0) is a chemical compound with the molecular formula C12H14O and a molecular weight of 174.24 g/mol. IUPAC name: 1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanone. InChIKey: VEPUKHYQNXSSKV-UHFFFAOYSA-N.
| Molecular formula | C12H14O |
|---|---|
| Molecular weight | 174.24 g/mol |
| IUPAC name | 1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanone |
| InChIKey | VEPUKHYQNXSSKV-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(CCCC2)C=C1 |
Computed by PubChem (NCBI)