cas: 4770-32-5 — see every product listed under this CAS number, including other names
1-(5-Hydroxyindolin-1-yl)ethanone, 95%, 95% (CAS 4770-32-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DYSB-100mg |
| cas | 4770-32-5 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 357.20 Pln | |
| Chemat | 250mg | 578.00 Pln | |
| Chemat | 1g | 1096.40 Pln | |
| Chemat | 5g | 2934.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(5-hydroxy-2,3-dihydroindol-1-yl)ethanone (CAS 4770-32-5) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 1-(5-hydroxy-2,3-dihydroindol-1-yl)ethanone. InChIKey: YGWPWLRFBWRAMA-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 1-(5-hydroxy-2,3-dihydroindol-1-yl)ethanone |
| InChIKey | YGWPWLRFBWRAMA-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCC2=C1C=CC(=C2)O |
Computed by PubChem (NCBI)