cas: 1302580-98-8 — see every product listed under this CAS number, including other names
1-(5-fluoropyridin-2-yl)cyclopropane-1-carboxylic acid, 98%, 98% (CAS 1302580-98-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110J50-100mg |
| cas | 1302580-98-8 |
| size | 100mg |
| availability | 250g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 510.80 Pln | |
| Chemat | 5g | 2128.40 Pln | |
| Chemat | 10g | 3506.00 Pln | |
| Chemat | 50g | 6698.00 Pln | |
| Chemat | 100g | 11128.40 Pln | |
| Chemat | 250g | 22206.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-(5-fluoro-2-pyridinyl)cyclopropane-1-carboxylic acid (CAS 1302580-98-8) is a chemical compound with the molecular formula C9H8FNO2 and a molecular weight of 181.16 g/mol. IUPAC name: 1-(5-fluoro-2-pyridinyl)cyclopropane-1-carboxylic acid. InChIKey: KLVFERIITBXTIL-UHFFFAOYSA-N.
| Molecular formula | C9H8FNO2 |
|---|---|
| Molecular weight | 181.16 g/mol |
| IUPAC name | 1-(5-fluoro-2-pyridinyl)cyclopropane-1-carboxylic acid |
| InChIKey | KLVFERIITBXTIL-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=NC=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)