CAS 2426639-49-6 is the registry number for 6-Fluoro-7-methoxy-3-methyl-benzo[c]isoxazole, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
6-fluoro-7-methoxy-3-methyl-2,1-benzoxazole (CAS 2426639-49-6) is a chemical compound with the molecular formula C9H8FNO2 and a molecular weight of 181.16 g/mol. IUPAC name: 6-fluoro-7-methoxy-3-methyl-2,1-benzoxazole. InChIKey: WLOJGTLYRVRAEH-UHFFFAOYSA-N.
| Molecular formula | C9H8FNO2 |
|---|---|
| Molecular weight | 181.16 g/mol |
| IUPAC name | 6-fluoro-7-methoxy-3-methyl-2,1-benzoxazole |
| InChIKey | WLOJGTLYRVRAEH-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CC(=C(C2=NO1)OC)F |
Computed by PubChem (NCBI)