Products 1402664-71-4
CAS 1402664-71-4 appears in our catalog under these names: 5-Cyclopropyl-2-fluoropyridine-3-carboxylic acid, 95%, 5-Cyclopropyl-2-fluoropyridine-3-carboxylic acid 95%, 5-Cyclopropyl-2-fluoropyridine-3-carboxylic acid. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 10g, 5g, 250mg, 1g, 25mg, 50mg, 100mg.
5-cyclopropyl-2-fluoropyridine-3-carboxylic acid (CAS 1402664-71-4) is a chemical compound with the molecular formula C9H8FNO2 and a molecular weight of 181.16 g/mol. IUPAC name: 5-cyclopropyl-2-fluoropyridine-3-carboxylic acid. InChIKey: IRBPDXKMJLIOJG-UHFFFAOYSA-N.
| Molecular formula | C9H8FNO2 |
|---|---|
| Molecular weight | 181.16 g/mol |
| IUPAC name | 5-cyclopropyl-2-fluoropyridine-3-carboxylic acid |
| InChIKey | IRBPDXKMJLIOJG-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC(=C(N=C2)F)C(=O)O |
Computed by PubChem (NCBI)