CAS 1260796-58-4 is the registry number for 6-Fluoro-4-methyl-2H-1,4-benzoxazin-3-one, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
6-fluoro-4-methyl-1,4-benzoxazin-3-one (CAS 1260796-58-4) is a chemical compound with the molecular formula C9H8FNO2 and a molecular weight of 181.16 g/mol. IUPAC name: 6-fluoro-4-methyl-1,4-benzoxazin-3-one. InChIKey: RUJLVTDBNLWGNZ-UHFFFAOYSA-N.
| Molecular formula | C9H8FNO2 |
|---|---|
| Molecular weight | 181.16 g/mol |
| IUPAC name | 6-fluoro-4-methyl-1,4-benzoxazin-3-one |
| InChIKey | RUJLVTDBNLWGNZ-UHFFFAOYSA-N |
| SMILES | CN1C(=O)COC2=C1C=C(C=C2)F |
Computed by PubChem (NCBI)