CAS 1798335-53-1 is the registry number for (R)-8-Fluoro-2-methyl-2h-benzo[b][1,4]oxazin-3(4h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 500mg.
(2R)-8-fluoro-2-methyl-4H-1,4-benzoxazin-3-one (CAS 1798335-53-1) is a chemical compound with the molecular formula C9H8FNO2 and a molecular weight of 181.16 g/mol. IUPAC name: (2R)-8-fluoro-2-methyl-4H-1,4-benzoxazin-3-one. InChIKey: SAPYXLJRKMNQGG-RXMQYKEDSA-N.
| Molecular formula | C9H8FNO2 |
|---|---|
| Molecular weight | 181.16 g/mol |
| IUPAC name | (2R)-8-fluoro-2-methyl-4H-1,4-benzoxazin-3-one |
| InChIKey | SAPYXLJRKMNQGG-RXMQYKEDSA-N |
| SMILES | C[C@@H]1C(=O)NC2=C(O1)C(=CC=C2)F |
Computed by PubChem (NCBI)