cas: 1035840-81-3 — see every product listed under this CAS number, including other names
1-(6-Chlorobenzo(d)oxazol-2-yl)piperidine-4-carboxylic acid, 97% (CAS 1035840-81-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A282794-10g |
| cas | 1035840-81-3 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 13780.06 Pln | |
| AmBeed | 5g | 9210.04 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-(6-chloro-1,3-benzoxazol-2-yl)piperidine-4-carboxylic acid (CAS 1035840-81-3) is a chemical compound with the molecular formula C13H13ClN2O3 and a molecular weight of 280.70 g/mol. IUPAC name: 1-(6-chloro-1,3-benzoxazol-2-yl)piperidine-4-carboxylic acid. InChIKey: QLKPIUVTPNKDQT-UHFFFAOYSA-N.
| Molecular formula | C13H13ClN2O3 |
|---|---|
| Molecular weight | 280.70 g/mol |
| IUPAC name | 1-(6-chloro-1,3-benzoxazol-2-yl)piperidine-4-carboxylic acid |
| InChIKey | QLKPIUVTPNKDQT-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)O)C2=NC3=C(O2)C=C(C=C3)Cl |
Computed by PubChem (NCBI)