CAS 1423017-83-7 is the registry number for 9-Formyl-1,2,3,4-tetrahydronorharman-l-3-carboxylic acid hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(3S)-9-formyl-1,2,3,4-tetrahydropyrido[3,4-b]indole-3-carboxylic acid;hydrochloride (CAS 1423017-83-7) is a chemical compound with the molecular formula C13H13ClN2O3 and a molecular weight of 280.70 g/mol. IUPAC name: (3S)-9-formyl-1,2,3,4-tetrahydropyrido[3,4-b]indole-3-carboxylic acid;hydrochloride. InChIKey: VUKZGGNDTMVNEL-PPHPATTJSA-N.
| Molecular formula | C13H13ClN2O3 |
|---|---|
| Molecular weight | 280.70 g/mol |
| IUPAC name | (3S)-9-formyl-1,2,3,4-tetrahydropyrido[3,4-b]indole-3-carboxylic acid;hydrochloride |
| InChIKey | VUKZGGNDTMVNEL-PPHPATTJSA-N |
| SMILES | C1[C@H](NCC2=C1C3=CC=CC=C3N2C=O)C(=O)O.Cl |
Computed by PubChem (NCBI)