Products 79189-76-7

CAS 79189-76-7 is the registry number for 2-(2-Chloro-acetylamino)-3-(1h-indol-3-yl)-propionic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

2-[(2-chloroacetyl)amino]-3-(1H-indol-3-yl)propanoic acid (CAS 79189-76-7) is a chemical compound with the molecular formula C13H13ClN2O3 and a molecular weight of 280.70 g/mol. IUPAC name: 2-[(2-chloroacetyl)amino]-3-(1H-indol-3-yl)propanoic acid. InChIKey: PGTJUXHMJYBSBW-UHFFFAOYSA-N.

Identity
Molecular formulaC13H13ClN2O3
Molecular weight280.70 g/mol
IUPAC name2-[(2-chloroacetyl)amino]-3-(1H-indol-3-yl)propanoic acid
InChIKeyPGTJUXHMJYBSBW-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=CN2)CC(C(=O)O)NC(=O)CCl

Computed by PubChem (NCBI)