Products 1035840-81-3
CAS 1035840-81-3 appears in our catalog under these names: 1-(6-Chloro-1,3-benzoxazol-2-yl)piperidine-4-carboxylic acid, 95%, 1-(6-Chlorobenzo(d)oxazol-2-yl)piperidine-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 10g, 1g.
1-(6-chloro-1,3-benzoxazol-2-yl)piperidine-4-carboxylic acid (CAS 1035840-81-3) is a chemical compound with the molecular formula C13H13ClN2O3 and a molecular weight of 280.70 g/mol. IUPAC name: 1-(6-chloro-1,3-benzoxazol-2-yl)piperidine-4-carboxylic acid. InChIKey: QLKPIUVTPNKDQT-UHFFFAOYSA-N.
| Molecular formula | C13H13ClN2O3 |
|---|---|
| Molecular weight | 280.70 g/mol |
| IUPAC name | 1-(6-chloro-1,3-benzoxazol-2-yl)piperidine-4-carboxylic acid |
| InChIKey | QLKPIUVTPNKDQT-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)O)C2=NC3=C(O2)C=C(C=C3)Cl |
Computed by PubChem (NCBI)