CAS 936074-51-0 is the registry number for 1-(5-Chlorobenzo[d]oxazol-2-yl)piperidine-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 100mg.
1-(5-chloro-1,3-benzoxazol-2-yl)piperidine-4-carboxylic acid (CAS 936074-51-0) is a chemical compound with the molecular formula C13H13ClN2O3 and a molecular weight of 280.70 g/mol. IUPAC name: 1-(5-chloro-1,3-benzoxazol-2-yl)piperidine-4-carboxylic acid. InChIKey: ZWXCRCVLSBGYFC-UHFFFAOYSA-N.
| Molecular formula | C13H13ClN2O3 |
|---|---|
| Molecular weight | 280.70 g/mol |
| IUPAC name | 1-(5-chloro-1,3-benzoxazol-2-yl)piperidine-4-carboxylic acid |
| InChIKey | ZWXCRCVLSBGYFC-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)O)C2=NC3=C(O2)C=CC(=C3)Cl |
Computed by PubChem (NCBI)