Products 936074-51-0

CAS 936074-51-0 is the registry number for 1-(5-Chlorobenzo[d]oxazol-2-yl)piperidine-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 100mg.

Structural formula: {0} (CAS {1})

1-(5-chloro-1,3-benzoxazol-2-yl)piperidine-4-carboxylic acid (CAS 936074-51-0) is a chemical compound with the molecular formula C13H13ClN2O3 and a molecular weight of 280.70 g/mol. IUPAC name: 1-(5-chloro-1,3-benzoxazol-2-yl)piperidine-4-carboxylic acid. InChIKey: ZWXCRCVLSBGYFC-UHFFFAOYSA-N.

Identity
Molecular formulaC13H13ClN2O3
Molecular weight280.70 g/mol
IUPAC name1-(5-chloro-1,3-benzoxazol-2-yl)piperidine-4-carboxylic acid
InChIKeyZWXCRCVLSBGYFC-UHFFFAOYSA-N
SMILESC1CN(CCC1C(=O)O)C2=NC3=C(O2)C=CC(=C3)Cl

Computed by PubChem (NCBI)