cas: 366498-47-7 — see every product listed under this CAS number, including other names
1-(Benzo(d)(1,3)dioxol-5-yl)guanidine, 97% (CAS 366498-47-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A629139-5g |
| cas | 366498-47-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 10648.75 Pln | |
| AmBeed | 10g | 14880.25 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(1,3-benzodioxol-5-yl)guanidine (CAS 366498-47-7) is a chemical compound with the molecular formula C8H9N3O2 and a molecular weight of 179.18 g/mol. IUPAC name: 2-(1,3-benzodioxol-5-yl)guanidine. InChIKey: OZINHCFSCQEUPW-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O2 |
|---|---|
| Molecular weight | 179.18 g/mol |
| IUPAC name | 2-(1,3-benzodioxol-5-yl)guanidine |
| InChIKey | OZINHCFSCQEUPW-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)N=C(N)N |
Computed by PubChem (NCBI)