CAS 926218-66-8 appears in our catalog under these names: 5-(2,5-Dimethyl-3-furyl)-1,3,4-oxadiazol-2-amine, 95%, 5-(2,5-Dimethylfuran-3-yl)-1,3,4-oxadiazol-2-amine, 97%, 5-(2,5-Dimethylfuran-3-yl)-1,3,4-oxadiazol-2-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 10g, 100mg.
5-(2,5-dimethylfuran-3-yl)-1,3,4-oxadiazol-2-amine (CAS 926218-66-8) is a chemical compound with the molecular formula C8H9N3O2 and a molecular weight of 179.18 g/mol. IUPAC name: 5-(2,5-dimethylfuran-3-yl)-1,3,4-oxadiazol-2-amine. InChIKey: YAKHQTKBLTVDPB-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O2 |
|---|---|
| Molecular weight | 179.18 g/mol |
| IUPAC name | 5-(2,5-dimethylfuran-3-yl)-1,3,4-oxadiazol-2-amine |
| InChIKey | YAKHQTKBLTVDPB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(O1)C)C2=NN=C(O2)N |
Computed by PubChem (NCBI)