CAS 1197478-26-4 appears in our catalog under these names: 5-Methyl-1-(5-methyl-1,2-oxazol-3-yl)-2,3-dihydro-1h-imidazol-2-one, 95%, 5-Methyl-1-(5-methyl-1,2-oxazol-3-yl)-2,3-dihydro-1H-imidazol-2-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
4-methyl-3-(5-methyl-1,2-oxazol-3-yl)-1H-imidazol-2-one (CAS 1197478-26-4) is a chemical compound with the molecular formula C8H9N3O2 and a molecular weight of 179.18 g/mol. IUPAC name: 4-methyl-3-(5-methyl-1,2-oxazol-3-yl)-1H-imidazol-2-one. InChIKey: YAZHJODVVNWBGT-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O2 |
|---|---|
| Molecular weight | 179.18 g/mol |
| IUPAC name | 4-methyl-3-(5-methyl-1,2-oxazol-3-yl)-1H-imidazol-2-one |
| InChIKey | YAZHJODVVNWBGT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NO1)N2C(=CNC2=O)C |
Computed by PubChem (NCBI)