CAS 366498-47-7 appears in our catalog under these names: N-(1,3-benzodioxol-5-yl)guanidine, 95%, 1-(Benzo(d)(1,3)dioxol-5-yl)guanidine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
2-(1,3-benzodioxol-5-yl)guanidine (CAS 366498-47-7) is a chemical compound with the molecular formula C8H9N3O2 and a molecular weight of 179.18 g/mol. IUPAC name: 2-(1,3-benzodioxol-5-yl)guanidine. InChIKey: OZINHCFSCQEUPW-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O2 |
|---|---|
| Molecular weight | 179.18 g/mol |
| IUPAC name | 2-(1,3-benzodioxol-5-yl)guanidine |
| InChIKey | OZINHCFSCQEUPW-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)N=C(N)N |
Computed by PubChem (NCBI)