CAS 3030-97-5 appears in our catalog under these names: 2-Hydroxybenzaldehyde semicarbazone, 95%, 2-(2-Hydroxybenzylidene)hydrazinecarboxamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g, 2g.
[(E)-(2-hydroxyphenyl)methylideneamino]urea (CAS 3030-97-5) is a chemical compound with the molecular formula C8H9N3O2 and a molecular weight of 179.18 g/mol. IUPAC name: [(E)-(2-hydroxyphenyl)methylideneamino]urea. InChIKey: IZXDQSKCOWSUOG-BJMVGYQFSA-N.
| Molecular formula | C8H9N3O2 |
|---|---|
| Molecular weight | 179.18 g/mol |
| IUPAC name | [(E)-(2-hydroxyphenyl)methylideneamino]urea |
| InChIKey | IZXDQSKCOWSUOG-BJMVGYQFSA-N |
| SMILES | C1=CC=C(C(=C1)/C=N/NC(=O)N)O |
Computed by PubChem (NCBI)