cas: 1881289-27-5 — see every product listed under this CAS number, including other names
1-(Benzyloxy)-3-chloro-2,4-difluorobenzene, 95%, 95% (CAS 1881289-27-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I2ZJ-100mg |
| cas | 1881289-27-5 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1163.60 Pln | |
| Chemat | 250mg | 1854.80 Pln | |
| Chemat | 1g | 3054.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-chloro-1,3-difluoro-4-phenylmethoxybenzene (CAS 1881289-27-5) is a chemical compound with the molecular formula C13H9ClF2O and a molecular weight of 254.66 g/mol. IUPAC name: 2-chloro-1,3-difluoro-4-phenylmethoxybenzene. InChIKey: GLBZQNFCJHEXJZ-UHFFFAOYSA-N.
| Molecular formula | C13H9ClF2O |
|---|---|
| Molecular weight | 254.66 g/mol |
| IUPAC name | 2-chloro-1,3-difluoro-4-phenylmethoxybenzene |
| InChIKey | GLBZQNFCJHEXJZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C(=C(C=C2)F)Cl)F |
Computed by PubChem (NCBI)