cas: 24318-02-3 — see every product listed under this CAS number, including other names
1-(Benzyloxy)-3-chlorobenzene, ≥97-<99% (CAS 24318-02-3) is a chemical reagent available from Chemat. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC5425-97-99-2.5g |
| cas | 24318-02-3 |
| size | 2,5g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 2,5g | 3950.98 Pln | |
| Hoffman Fine Chemicals | 5g | 5928.78 Pln | |
| Hoffman Fine Chemicals | 10g | 9310.18 Pln | |
| Hoffman Fine Chemicals | 25g | 18312.36 Pln | |
| Hoffman Fine Chemicals | 50g | 29113.70 Pln | |
| Hoffman Fine Chemicals | 100g | 49274.50 Pln |
| purity | ≥97-<99% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
1-chloro-3-phenylmethoxybenzene (CAS 24318-02-3) is a chemical compound with the molecular formula C13H11ClO and a molecular weight of 218.68 g/mol. IUPAC name: 1-chloro-3-phenylmethoxybenzene. InChIKey: WIJUFHLXUSIELP-UHFFFAOYSA-N.
| Molecular formula | C13H11ClO |
|---|---|
| Molecular weight | 218.68 g/mol |
| IUPAC name | 1-chloro-3-phenylmethoxybenzene |
| InChIKey | WIJUFHLXUSIELP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)