cas: 24318-02-3 — see every product listed under this CAS number, including other names
Benzyl 3-chlorophenyl ether, 97% (CAS 24318-02-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F630837-100MG |
| cas | 24318-02-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 513.38 Pln | |
| Fluorochem | 250mg | 820.56 Pln | |
| Fluorochem | 1g | 2064.92 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-chloro-3-phenylmethoxybenzene (CAS 24318-02-3) is a chemical compound with the molecular formula C13H11ClO and a molecular weight of 218.68 g/mol. IUPAC name: 1-chloro-3-phenylmethoxybenzene. InChIKey: WIJUFHLXUSIELP-UHFFFAOYSA-N.
| Molecular formula | C13H11ClO |
|---|---|
| Molecular weight | 218.68 g/mol |
| IUPAC name | 1-chloro-3-phenylmethoxybenzene |
| InChIKey | WIJUFHLXUSIELP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)