cas: 210366-15-7 — see every product listed under this CAS number, including other names
1-(Benzyloxy)-6-Oxo-1,6-Dihydropyridine-2-Carboxylic Acid, 96%, 96% (CAS 210366-15-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113KQD-100mg |
| cas | 210366-15-7 |
| size | 100mg |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 904.40 Pln | |
| Chemat | 25g | 2853.20 Pln | |
| Chemat | 100g | 9419.60 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
6-oxo-1-phenylmethoxypyridine-2-carboxylic acid (CAS 210366-15-7) is a chemical compound with the molecular formula C13H11NO4 and a molecular weight of 245.23 g/mol. IUPAC name: 6-oxo-1-phenylmethoxypyridine-2-carboxylic acid. InChIKey: CIUDQXNWTGQYIC-UHFFFAOYSA-N.
| Molecular formula | C13H11NO4 |
|---|---|
| Molecular weight | 245.23 g/mol |
| IUPAC name | 6-oxo-1-phenylmethoxypyridine-2-carboxylic acid |
| InChIKey | CIUDQXNWTGQYIC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CON2C(=O)C=CC=C2C(=O)O |
Computed by PubChem (NCBI)