cas: 210366-15-7 — see every product listed under this CAS number, including other names
1-(Benzyloxy)-6-oxo-1,6-dihydropyridine-2-carboxylic acid 96% (CAS 210366-15-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A170986-250mg |
| cas | 210366-15-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 292.50 Pln | |
| Ambeed | 5g | 1093.50 Pln | |
| Ambeed | 25g | 3841.38 Pln | |
| Ambeed | 100g | 12135.06 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A170986 |
6-oxo-1-phenylmethoxypyridine-2-carboxylic acid (CAS 210366-15-7) is a chemical compound with the molecular formula C13H11NO4 and a molecular weight of 245.23 g/mol. IUPAC name: 6-oxo-1-phenylmethoxypyridine-2-carboxylic acid. InChIKey: CIUDQXNWTGQYIC-UHFFFAOYSA-N.
| Molecular formula | C13H11NO4 |
|---|---|
| Molecular weight | 245.23 g/mol |
| IUPAC name | 6-oxo-1-phenylmethoxypyridine-2-carboxylic acid |
| InChIKey | CIUDQXNWTGQYIC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CON2C(=O)C=CC=C2C(=O)O |
Computed by PubChem (NCBI)