cas: 198649-68-2 — see every product listed under this CAS number, including other names
1-(Bromomethyl)-2-(trifluoromethoxy)benzene, 96% (stabilized withHQ+CaCO3), 96% (stabilized withHQ+CaCO3) (CAS 198649-68-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 15g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113BNT-1g |
| cas | 198649-68-2 |
| size | 1g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 126.80 Pln | |
| Chemat | 10g | 184.40 Pln | |
| Chemat | 15g | 242.00 Pln | |
| Chemat | 25g | 290.00 Pln | |
| Chemat | 100g | 976.40 Pln |
| purity | 96% (stabilized withHQ+CaCO3) |
|---|---|
| delivery time | 3 weeks |
1-(bromomethyl)-2-(trifluoromethoxy)benzene (CAS 198649-68-2) is a chemical compound with the molecular formula C8H6BrF3O and a molecular weight of 255.03 g/mol. IUPAC name: 1-(bromomethyl)-2-(trifluoromethoxy)benzene. InChIKey: TUNSVUOTVLWNQT-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3O |
|---|---|
| Molecular weight | 255.03 g/mol |
| IUPAC name | 1-(bromomethyl)-2-(trifluoromethoxy)benzene |
| InChIKey | TUNSVUOTVLWNQT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CBr)OC(F)(F)F |
Computed by PubChem (NCBI)