cas: 198649-68-2 — see every product listed under this CAS number, including other names
2-(Trifluoromethoxy)benzyl Bromide, >98.0%(GC) (CAS 198649-68-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T2311-1G |
| cas | 198649-68-2 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 257.52 Pln | |
| TCI | 5g | 645.98 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
1-(bromomethyl)-2-(trifluoromethoxy)benzene (CAS 198649-68-2) is a chemical compound with the molecular formula C8H6BrF3O and a molecular weight of 255.03 g/mol. IUPAC name: 1-(bromomethyl)-2-(trifluoromethoxy)benzene. InChIKey: TUNSVUOTVLWNQT-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3O |
|---|---|
| Molecular weight | 255.03 g/mol |
| IUPAC name | 1-(bromomethyl)-2-(trifluoromethoxy)benzene |
| InChIKey | TUNSVUOTVLWNQT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CBr)OC(F)(F)F |
Computed by PubChem (NCBI)