cas: 3958-57-4 — see every product listed under this CAS number, including other names
1-(Bromomethyl)-3-nitrobenzene, 98%, 98% (CAS 3958-57-4) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114JTA-25g |
| cas | 3958-57-4 |
| size | 25g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 146.00 Pln | |
| Chemat | 100g | 419.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-(bromomethyl)-3-nitrobenzene (CAS 3958-57-4) is a chemical compound with the molecular formula C7H6BrNO2 and a molecular weight of 216.03 g/mol. IUPAC name: 1-(bromomethyl)-3-nitrobenzene. InChIKey: LNWXALCHPJANMJ-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO2 |
|---|---|
| Molecular weight | 216.03 g/mol |
| IUPAC name | 1-(bromomethyl)-3-nitrobenzene |
| InChIKey | LNWXALCHPJANMJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])CBr |
Computed by PubChem (NCBI)