cas: 3958-57-4 — see every product listed under this CAS number, including other names
3-Nitrobenzyl Bromide, >98.0%(GC) (CAS 3958-57-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | N0625-10G |
| cas | 3958-57-4 |
| size | 10g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 10g | 193.59 Pln | |
| TCI | 25g | 242.77 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
1-(bromomethyl)-3-nitrobenzene (CAS 3958-57-4) is a chemical compound with the molecular formula C7H6BrNO2 and a molecular weight of 216.03 g/mol. IUPAC name: 1-(bromomethyl)-3-nitrobenzene. InChIKey: LNWXALCHPJANMJ-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO2 |
|---|---|
| Molecular weight | 216.03 g/mol |
| IUPAC name | 1-(bromomethyl)-3-nitrobenzene |
| InChIKey | LNWXALCHPJANMJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])CBr |
Computed by PubChem (NCBI)