cas: 1214383-50-2 — see every product listed under this CAS number, including other names
1-(Difluoromethyl)-2-fluoro-3-nitrobenzene, 97% (CAS 1214383-50-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F777015-100MG |
| cas | 1214383-50-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1034.03 Pln | |
| Fluorochem | 250mg | 1716.08 Pln | |
| Fluorochem | 1g | 4074.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-(difluoromethyl)-2-fluoro-3-nitrobenzene (CAS 1214383-50-2) is a chemical compound with the molecular formula C7H4F3NO2 and a molecular weight of 191.11 g/mol. IUPAC name: 1-(difluoromethyl)-2-fluoro-3-nitrobenzene. InChIKey: LVPDSOXLXWWHNG-UHFFFAOYSA-N.
| Molecular formula | C7H4F3NO2 |
|---|---|
| Molecular weight | 191.11 g/mol |
| IUPAC name | 1-(difluoromethyl)-2-fluoro-3-nitrobenzene |
| InChIKey | LVPDSOXLXWWHNG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])F)C(F)F |
Computed by PubChem (NCBI)