CAS 1119450-11-1 appears in our catalog under these names: (3,5,6-Trifluoropyridin-2-yl)acetic acid, 95%, 2-(3,5,6-Trifluoropyridin-2-yl)acetic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-(3,5,6-trifluoro-2-pyridinyl)acetic acid (CAS 1119450-11-1) is a chemical compound with the molecular formula C7H4F3NO2 and a molecular weight of 191.11 g/mol. IUPAC name: 2-(3,5,6-trifluoro-2-pyridinyl)acetic acid. InChIKey: BKXRMAATAYYXEW-UHFFFAOYSA-N.
| Molecular formula | C7H4F3NO2 |
|---|---|
| Molecular weight | 191.11 g/mol |
| IUPAC name | 2-(3,5,6-trifluoro-2-pyridinyl)acetic acid |
| InChIKey | BKXRMAATAYYXEW-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=C1F)F)CC(=O)O)F |
Computed by PubChem (NCBI)