CAS 119385-80-7 appears in our catalog under these names: 3-Amino-2,4,5-trifluorobenzoic acid, 95%, 3-AMINO-2,4,5-TRIFLUOROBENZOIC ACID, 95%, 95%, 3-Amino-2,4,5-trifluorobenzoic acid, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 100g, 10g.
3-amino-2,4,5-trifluorobenzoic acid (CAS 119385-80-7) is a chemical compound with the molecular formula C7H4F3NO2 and a molecular weight of 191.11 g/mol. IUPAC name: 3-amino-2,4,5-trifluorobenzoic acid. InChIKey: NVWVZPFPZJYLNK-UHFFFAOYSA-N.
| Molecular formula | C7H4F3NO2 |
|---|---|
| Molecular weight | 191.11 g/mol |
| IUPAC name | 3-amino-2,4,5-trifluorobenzoic acid |
| InChIKey | NVWVZPFPZJYLNK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)N)F)C(=O)O |
Computed by PubChem (NCBI)