Products 133622-65-8
CAS 133622-65-8 appears in our catalog under these names: 3-Amino-2,5,6-trifluorobenzoic acid, 95%, 3-Amino-2,5,6-trifluorobenzoic acid, 97%, 3-Amino-2,5,6-trifluorobenzoic acid, 3-Amino-2,5,6-trifluorobenzoic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 2g, 10g, 100mg, 250mg.
3-amino-2,5,6-trifluorobenzoic acid (CAS 133622-65-8) is a chemical compound with the molecular formula C7H4F3NO2 and a molecular weight of 191.11 g/mol. IUPAC name: 3-amino-2,5,6-trifluorobenzoic acid. InChIKey: FXEMCOVVTSYFRJ-UHFFFAOYSA-N.
| Molecular formula | C7H4F3NO2 |
|---|---|
| Molecular weight | 191.11 g/mol |
| IUPAC name | 3-amino-2,5,6-trifluorobenzoic acid |
| InChIKey | FXEMCOVVTSYFRJ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)C(=O)O)F)N |
Computed by PubChem (NCBI)