CAS 384-22-5 appears in our catalog under these names: 2-Nitrobenzotrifluoride, 95%, 2-Nitrobenzotrifluoride, >95% (HPLC), 2-Nitrotrifluoromethylbenzene, 2-Nitrobenzotrifluoride, 98%. Offered by: Combi-blocks, TRC, Mikromol, Thermo Scientific (Acros). Available pack sizes: 500g, 100g, 25g, 100mg, 500mg, 50mg, 25mg, 1g.
1-nitro-2-(trifluoromethyl)benzene (CAS 384-22-5) is a chemical compound with the molecular formula C7H4F3NO2 and a molecular weight of 191.11 g/mol. IUPAC name: 1-nitro-2-(trifluoromethyl)benzene. InChIKey: NDZJSUCUYPZXPR-UHFFFAOYSA-N.
| Molecular formula | C7H4F3NO2 |
|---|---|
| Molecular weight | 191.11 g/mol |
| IUPAC name | 1-nitro-2-(trifluoromethyl)benzene |
| InChIKey | NDZJSUCUYPZXPR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)