1-(Mesitylsulfonyl)-3-nitro-1H-1,2,4-triazole, 97%
cas: 74257-00-4 — see every product listed under this CAS number, including other names
1-(Mesitylsulfonyl)-3-nitro-1H-1,2,4-triazole, 97% (CAS 74257-00-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A204347-1g |
| cas | 74257-00-4 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 153.44 Pln | |
| Ambeed | 5g | 220.19 Pln | |
| Ambeed | 10g | 292.50 Pln | |
| Ambeed | 25g | 498.31 Pln | |
| Ambeed | 100g | 1777.69 Pln | |
| Ambeed | 500g | 6572.56 Pln | |
| BLDpharm | 1g | 131.09 Pln | |
| BLDpharm | 5g | 203.29 Pln | |
| BLDpharm | 10g | 308.80 Pln | |
| BLDpharm | 25g | 530.95 Pln | |
| BLDpharm | 100g | 1913.80 Pln | |
| BLDpharm | 500g | 6401.10 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
3-nitro-1-(2,4,6-trimethylphenyl)sulfonyl-1,2,4-triazole (CAS 74257-00-4) is a chemical compound with the molecular formula C11H12N4O4S and a molecular weight of 296.30 g/mol. IUPAC name: 3-nitro-1-(2,4,6-trimethylphenyl)sulfonyl-1,2,4-triazole. InChIKey: SFYDWLYPIXHPML-UHFFFAOYSA-N.
| Molecular formula | C11H12N4O4S |
|---|---|
| Molecular weight | 296.30 g/mol |
| IUPAC name | 3-nitro-1-(2,4,6-trimethylphenyl)sulfonyl-1,2,4-triazole |
| InChIKey | SFYDWLYPIXHPML-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)S(=O)(=O)N2C=NC(=N2)[N+](=O)[O-])C |
Computed by PubChem (NCBI)
Synonyms:
3-Nitro-1-(2,4,6-trimethylbenzene-1-sulfonyl)-1H-1,2,4-triazole, 1-(mesitylsulfonyl)-3-nitro-1h-1,2,4-triazole, 1-(mesitylene-2-sulfonyl)-3-nitro-1,2,4-triazole, MSNT, 1-(mesitylene-2-sulfonyl)-3-nitro-1h-1,2,4-triazole, 1-(2-Mesitylenesulfonyl)-3-nitro-1H-1,2,4-triazole, 3-nitro-1-(2,4,6-trimethylphenyl)sulfonyl-1,2,4-triazole, 1-(Mesitylene-2-sulfonyl-3-nitro-1,2,4-triazole, 1-(2,4,6-Trimethylphenylsulfonyl)-3-nitro-1,2,4-triazole, (2,4,6-Trimethylphenyl)-(3-nitro-1,2,4-triazol-1-yl) sulfone