Products 852657-49-9

CAS 852657-49-9 is the registry number for ((1-Phenyl-1H-tetrazol-5-yl)sulfonyl)acetic Acid Ethyl Ester. Offered by: TRC. Available pack sizes: 100mg, 250mg, 25mg.

Structural formula: {0} (CAS {1})

Ethyl 2-(1-phenyltetrazol-5-yl)sulfonylacetate (CAS 852657-49-9) is a chemical compound with the molecular formula C11H12N4O4S and a molecular weight of 296.30 g/mol. IUPAC name: ethyl 2-(1-phenyltetrazol-5-yl)sulfonylacetate. InChIKey: VBRKQLJQBBGBKF-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12N4O4S
Molecular weight296.30 g/mol
IUPAC nameethyl 2-(1-phenyltetrazol-5-yl)sulfonylacetate
InChIKeyVBRKQLJQBBGBKF-UHFFFAOYSA-N
SMILESCCOC(=O)CS(=O)(=O)C1=NN=NN1C2=CC=CC=C2

Computed by PubChem (NCBI)