CAS 19868-00-9 is the registry number for Sulfadimethoxine EP Impurity F. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-N-(4-methoxy-2-oxo-1H-pyrimidin-6-yl)benzenesulfonamide (CAS 19868-00-9) is a chemical compound with the molecular formula C11H12N4O4S and a molecular weight of 296.30 g/mol. IUPAC name: 4-amino-N-(4-methoxy-2-oxo-1H-pyrimidin-6-yl)benzenesulfonamide. InChIKey: FHYFQJYPWDQZKU-UHFFFAOYSA-N.
| Molecular formula | C11H12N4O4S |
|---|---|
| Molecular weight | 296.30 g/mol |
| IUPAC name | 4-amino-N-(4-methoxy-2-oxo-1H-pyrimidin-6-yl)benzenesulfonamide |
| InChIKey | FHYFQJYPWDQZKU-UHFFFAOYSA-N |
| SMILES | COC1=NC(=O)NC(=C1)NS(=O)(=O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)