CAS 1184252-63-8 is the registry number for 3-{((4-Methyl-4H-1,2,4-triazol-3-yl)methyl)sulfamoyl}benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-[(4-methyl-1,2,4-triazol-3-yl)methylsulfamoyl]benzoic acid (CAS 1184252-63-8) is a chemical compound with the molecular formula C11H12N4O4S and a molecular weight of 296.30 g/mol. IUPAC name: 3-[(4-methyl-1,2,4-triazol-3-yl)methylsulfamoyl]benzoic acid. InChIKey: NFNFPZURLIFFEB-UHFFFAOYSA-N.
| Molecular formula | C11H12N4O4S |
|---|---|
| Molecular weight | 296.30 g/mol |
| IUPAC name | 3-[(4-methyl-1,2,4-triazol-3-yl)methylsulfamoyl]benzoic acid |
| InChIKey | NFNFPZURLIFFEB-UHFFFAOYSA-N |
| SMILES | CN1C=NN=C1CNS(=O)(=O)C2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)