CAS 74257-00-4 appears in our catalog under these names: 1–(Mesitylene–2–sulfonyl)–3–nitro–1,2,4–triazole, MSNT, 1-(2-Mesitylenesulfonyl)-3-nitro-1H-1,2,4-triazole, 99+% , 1-(Mesitylene-2-sulfonyl)-3-nitro-1,2,4-triazole, 1-(Mesitylene-2-sulfonyl)-3-nitro-1,2,4-triazole, 98%. Offered by: GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Biosynth, Thermo Scientific (Acros). Available pack sizes: 100g, 25g, 5g, 1kg, 1g, 10g, 50g.
3-nitro-1-(2,4,6-trimethylphenyl)sulfonyl-1,2,4-triazole (CAS 74257-00-4) is a chemical compound with the molecular formula C11H12N4O4S and a molecular weight of 296.30 g/mol. IUPAC name: 3-nitro-1-(2,4,6-trimethylphenyl)sulfonyl-1,2,4-triazole. InChIKey: SFYDWLYPIXHPML-UHFFFAOYSA-N.
| Molecular formula | C11H12N4O4S |
|---|---|
| Molecular weight | 296.30 g/mol |
| IUPAC name | 3-nitro-1-(2,4,6-trimethylphenyl)sulfonyl-1,2,4-triazole |
| InChIKey | SFYDWLYPIXHPML-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)S(=O)(=O)N2C=NC(=N2)[N+](=O)[O-])C |
Computed by PubChem (NCBI)