1-(THIOPHENE-2-SULFONYL)-PIPERIDINE-4-CARBOXYLIC ACID, 97%
cas: 327971-19-7 — see every product listed under this CAS number, including other names
1-(THIOPHENE-2-SULFONYL)-PIPERIDINE-4-CARBOXYLIC ACID, 97% (CAS 327971-19-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11BXEX-100mg |
| cas | 327971-19-7 |
| size | 100mg |
| availability | 20g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 280.40 Pln | |
| Chemat | 250mg | 453.20 Pln | |
| Chemat | 1g | 1120.40 Pln | |
| Chemat | 5g | 3491.60 Pln | |
| Chemat | 10g | 5123.60 Pln | |
| Fluorochem | 100mg | 586.27 Pln | |
| Fluorochem | 250mg | 794.53 Pln | |
| Fluorochem | 1g | 1554.68 Pln | |
| Fluorochem | 5g | 4428.67 Pln | |
| Fluorochem | 10g | 6391.52 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-thiophen-2-ylsulfonylpiperidine-4-carboxylic acid (CAS 327971-19-7) is a chemical compound with the molecular formula C10H13NO4S2 and a molecular weight of 275.3 g/mol. IUPAC name: 1-thiophen-2-ylsulfonylpiperidine-4-carboxylic acid. InChIKey: UHLPQMBGBPAJFX-UHFFFAOYSA-N.
| Molecular formula | C10H13NO4S2 |
|---|---|
| Molecular weight | 275.3 g/mol |
| IUPAC name | 1-thiophen-2-ylsulfonylpiperidine-4-carboxylic acid |
| InChIKey | UHLPQMBGBPAJFX-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)O)S(=O)(=O)C2=CC=CS2 |
Computed by PubChem (NCBI)
Synonyms:
1-(Thiophene-2-sulfonyl)-piperidine-4-carboxylic acid, 1-(2-thienylsulfonyl)piperidine-4-carboxylic acid, 1-(thiophene-2-sulfonyl)piperidine-4-carboxylic acid, 1-(thiophen-2-ylsulfonyl)piperidine-4-carboxylic acid, 1-thiophen-2-ylsulfonylpiperidine-4-carboxylic acid, 4-Piperidinecarboxylic acid, 1-(2-thienylsulfonyl)-, IFLab1_003502, Cambridge id 7209955, Oprea1_140672, UHLPQMBGBPAJFX-UHFFFAOYSA-N