CAS 212207-24-4 is the registry number for Benzocaine Methanethiosulfonate. Offered by: TRC. Available pack sizes: 10mg, 2mg, 5mg.
2-methylsulfonylsulfanylethyl 4-aminobenzoate (CAS 212207-24-4) is a chemical compound with the molecular formula C10H13NO4S2 and a molecular weight of 275.3 g/mol. IUPAC name: 2-methylsulfonylsulfanylethyl 4-aminobenzoate. InChIKey: BFIKQFVRUBGWRC-UHFFFAOYSA-N.
| Molecular formula | C10H13NO4S2 |
|---|---|
| Molecular weight | 275.3 g/mol |
| IUPAC name | 2-methylsulfonylsulfanylethyl 4-aminobenzoate |
| InChIKey | BFIKQFVRUBGWRC-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)SCCOC(=O)C1=CC=C(C=C1)N |
Computed by PubChem (NCBI)