Products 212207-24-4

CAS 212207-24-4 is the registry number for Benzocaine Methanethiosulfonate. Offered by: TRC. Available pack sizes: 10mg, 2mg, 5mg.

Structural formula: {0} (CAS {1})

2-methylsulfonylsulfanylethyl 4-aminobenzoate (CAS 212207-24-4) is a chemical compound with the molecular formula C10H13NO4S2 and a molecular weight of 275.3 g/mol. IUPAC name: 2-methylsulfonylsulfanylethyl 4-aminobenzoate. InChIKey: BFIKQFVRUBGWRC-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13NO4S2
Molecular weight275.3 g/mol
IUPAC name2-methylsulfonylsulfanylethyl 4-aminobenzoate
InChIKeyBFIKQFVRUBGWRC-UHFFFAOYSA-N
SMILESCS(=O)(=O)SCCOC(=O)C1=CC=C(C=C1)N

Computed by PubChem (NCBI)