Products 1008281-37-5

CAS 1008281-37-5 is the registry number for 1-[(5-Methylthien-2-yl)sulfonyl]pyrrolidine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

1-(5-methylthiophen-2-yl)sulfonylpyrrolidine-2-carboxylic acid (CAS 1008281-37-5) is a chemical compound with the molecular formula C10H13NO4S2 and a molecular weight of 275.3 g/mol. IUPAC name: 1-(5-methylthiophen-2-yl)sulfonylpyrrolidine-2-carboxylic acid. InChIKey: XVCFDYYHZJBEBW-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13NO4S2
Molecular weight275.3 g/mol
IUPAC name1-(5-methylthiophen-2-yl)sulfonylpyrrolidine-2-carboxylic acid
InChIKeyXVCFDYYHZJBEBW-UHFFFAOYSA-N
SMILESCC1=CC=C(S1)S(=O)(=O)N2CCCC2C(=O)O

Computed by PubChem (NCBI)