Products 2038-15-5
CAS 2038-15-5 appears in our catalog under these names: 2,3-Dimethylbenzothiazolium Methyl Sulfate, 2,3-Dimethylbenzo[d]thiazol-3-ium methyl sulfate, 95%, 95%. Offered by: TRC, Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg.
2,3-dimethyl-1,3-benzothiazol-3-ium;methyl sulfate (CAS 2038-15-5) is a chemical compound with the molecular formula C10H13NO4S2 and a molecular weight of 275.3 g/mol. IUPAC name: 2,3-dimethyl-1,3-benzothiazol-3-ium;methyl sulfate. InChIKey: SJGPSJRZYHPVKB-UHFFFAOYSA-M.
| Molecular formula | C10H13NO4S2 |
|---|---|
| Molecular weight | 275.3 g/mol |
| IUPAC name | 2,3-dimethyl-1,3-benzothiazol-3-ium;methyl sulfate |
| InChIKey | SJGPSJRZYHPVKB-UHFFFAOYSA-M |
| SMILES | CC1=[N+](C2=CC=CC=C2S1)C.COS(=O)(=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
2,3-dimethylbenzo[d]thiazol-3-ium methyl sulfate, 2,3-dimethylbenzothiazolium methyl sulfate, 2,3-dimethyl-1,3-benzothiazol-3-ium;methyl sulfate, 2,3-Dimethyl-1,3-benzothiazol-3-ium methyl sulfate, 2,3-dimethylbenzothiazolium methylsulfate, Benzothiazolium,2,3-dimethyl-,methylsulfate, Benzothiazolium, 2,3-dimethyl-, methyl sulfate