CAS 1153477-05-4 appears in our catalog under these names: 2-(Ethenesulfonyl)-N,N-dimethylbenzene-1-sulfonamide, 95%, 2-(Ethenesulfonyl)-N,N-dimethylbenzene-1-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-ethenylsulfonyl-N,N-dimethylbenzenesulfonamide (CAS 1153477-05-4) is a chemical compound with the molecular formula C10H13NO4S2 and a molecular weight of 275.3 g/mol. IUPAC name: 2-ethenylsulfonyl-N,N-dimethylbenzenesulfonamide. InChIKey: GMTWDMSPOYGCGN-UHFFFAOYSA-N.
| Molecular formula | C10H13NO4S2 |
|---|---|
| Molecular weight | 275.3 g/mol |
| IUPAC name | 2-ethenylsulfonyl-N,N-dimethylbenzenesulfonamide |
| InChIKey | GMTWDMSPOYGCGN-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC=CC=C1S(=O)(=O)C=C |
Computed by PubChem (NCBI)