Products 2377605-99-5
CAS 2377605-99-5 appears in our catalog under these names: [3-Methyl-4-(4-methylpiperazine-1-sulfonyl)phenyl]boronic acid, 97%, (3-MEthyl-4-(4-methylpiperazine-1-sulfonyl)phenyl)boronic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g.
[3-methyl-4-(4-methylpiperazin-1-yl)sulfonylphenyl]boronic acid (CAS 2377605-99-5) is a chemical compound with the molecular formula C12H19BN2O4S and a molecular weight of 298.17 g/mol. IUPAC name: [3-methyl-4-(4-methylpiperazin-1-yl)sulfonylphenyl]boronic acid. InChIKey: JQFGJJLOYOFDQK-UHFFFAOYSA-N.
| Molecular formula | C12H19BN2O4S |
|---|---|
| Molecular weight | 298.17 g/mol |
| IUPAC name | [3-methyl-4-(4-methylpiperazin-1-yl)sulfonylphenyl]boronic acid |
| InChIKey | JQFGJJLOYOFDQK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)S(=O)(=O)N2CCN(CC2)C)C)(O)O |
Computed by PubChem (NCBI)