CAS 1864801-84-2 is the registry number for 2-Amino-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-amino-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide (CAS 1864801-84-2) is a chemical compound with the molecular formula C12H19BN2O4S and a molecular weight of 298.17 g/mol. IUPAC name: 2-amino-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide. InChIKey: VWVORVHBPHCYAK-UHFFFAOYSA-N.
| Molecular formula | C12H19BN2O4S |
|---|---|
| Molecular weight | 298.17 g/mol |
| IUPAC name | 2-amino-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenesulfonamide |
| InChIKey | VWVORVHBPHCYAK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)S(=O)(=O)N)N |
Computed by PubChem (NCBI)