Products 1704063-64-8
CAS 1704063-64-8 is the registry number for 2–(4–Ethylpiperazin–1–ylsulfonyl)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 1g.
[2-(4-ethylpiperazin-1-yl)sulfonylphenyl]boronic acid (CAS 1704063-64-8) is a chemical compound with the molecular formula C12H19BN2O4S and a molecular weight of 298.17 g/mol. IUPAC name: [2-(4-ethylpiperazin-1-yl)sulfonylphenyl]boronic acid. InChIKey: XQIAQQZWZZXAAR-UHFFFAOYSA-N.
| Molecular formula | C12H19BN2O4S |
|---|---|
| Molecular weight | 298.17 g/mol |
| IUPAC name | [2-(4-ethylpiperazin-1-yl)sulfonylphenyl]boronic acid |
| InChIKey | XQIAQQZWZZXAAR-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1S(=O)(=O)N2CCN(CC2)CC)(O)O |
Computed by PubChem (NCBI)