cas: 2232-08-8 — see every product listed under this CAS number, including other names
1-(p-Toluenesulfonyl)-1H-imidazole, 97% (CAS 2232-08-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F024322-10G |
| cas | 2232-08-8 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 96.86 Pln | |
| Fluorochem | 25g | 122.89 Pln | |
| Fluorochem | 100g | 221.81 Pln | |
| Fluorochem | 500g | 846.59 Pln | |
| Fluorochem | 1kg | 1632.78 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
1-(4-methylphenyl)sulfonylimidazole (CAS 2232-08-8) is a chemical compound with the molecular formula C10H10N2O2S and a molecular weight of 222.27 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonylimidazole. InChIKey: YJYMYJRAQYREBT-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2S |
|---|---|
| Molecular weight | 222.27 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonylimidazole |
| InChIKey | YJYMYJRAQYREBT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=CN=C2 |
Computed by PubChem (NCBI)