cas: 2232-08-8 — see every product listed under this CAS number, including other names
1-Tosylimidazole 98% (CAS 2232-08-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A116513-5g |
| cas | 2232-08-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 125.62 Pln | |
| Ambeed | 10g | 142.31 Pln | |
| Ambeed | 25g | 159.00 Pln | |
| Ambeed | 100g | 314.75 Pln | |
| Ambeed | 500g | 1204.75 Pln | |
| Ambeed | 1000g | 2039.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A116513 |
1-(4-methylphenyl)sulfonylimidazole (CAS 2232-08-8) is a chemical compound with the molecular formula C10H10N2O2S and a molecular weight of 222.27 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonylimidazole. InChIKey: YJYMYJRAQYREBT-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2S |
|---|---|
| Molecular weight | 222.27 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonylimidazole |
| InChIKey | YJYMYJRAQYREBT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=CN=C2 |
Computed by PubChem (NCBI)