cas: 2232-08-8 — see every product listed under this CAS number, including other names
1-Tosylimidazole, 99.77% (CAS 2232-08-8) is a chemical reagent available from Chemat. Available pack sizes: 100 g, 25 g, 50 g, 10mM/1mL, 250 g, 500 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W001965-100 g |
| cas | 2232-08-8 |
| size | 100 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 g | 459.01 Pln | |
| MedChemExpress | 25 g | 263.96 Pln | |
| MedChemExpress | 50 g | 347.56 Pln | |
| MedChemExpress | 10mM/1mL | 277.90 Pln | |
| MedChemExpress | 250 g | 807.31 Pln | |
| MedChemExpress | 500 g | 1150.97 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.77% |
1-(4-methylphenyl)sulfonylimidazole (CAS 2232-08-8) is a chemical compound with the molecular formula C10H10N2O2S and a molecular weight of 222.27 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonylimidazole. InChIKey: YJYMYJRAQYREBT-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2S |
|---|---|
| Molecular weight | 222.27 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonylimidazole |
| InChIKey | YJYMYJRAQYREBT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=CN=C2 |
Computed by PubChem (NCBI)