cas: 317830-84-5 — see every product listed under this CAS number, including other names
1-(tert-Butoxycarbonyl)-1H-indol-5-ylboronic acid pinacol ester 95% (CAS 317830-84-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A816055-100mg |
| cas | 317830-84-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 197.94 Pln | |
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 487.19 Pln | |
| Ambeed | 5g | 1538.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A816055 |
[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-5-yl]boronic acid (CAS 317830-84-5) is a chemical compound with the molecular formula C13H16BNO4 and a molecular weight of 261.08 g/mol. IUPAC name: [1-[(2-methylpropan-2-yl)oxycarbonyl]indol-5-yl]boronic acid. InChIKey: LMSHKSBYXDUUBM-UHFFFAOYSA-N.
| Molecular formula | C13H16BNO4 |
|---|---|
| Molecular weight | 261.08 g/mol |
| IUPAC name | [1-[(2-methylpropan-2-yl)oxycarbonyl]indol-5-yl]boronic acid |
| InChIKey | LMSHKSBYXDUUBM-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)N(C=C2)C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)