CAS 181365-26-4 appears in our catalog under these names: 1-(tert-Butoxycarbonyl)indole-3-boronic acid, 95%, (1-(tert-Butoxycarbonyl)-1H-indol-3-yl)boronic acid 97%, 1-Boc-indole-3-boronic Acid, 97%, 97%, (1-(tert-Butoxycarbonyl)-1H-indol-3-yl)boronic acid, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 100g, 1g, 100mg, 250mg, 500mg.
[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]boronic acid (CAS 181365-26-4) is a chemical compound with the molecular formula C13H16BNO4 and a molecular weight of 261.08 g/mol. IUPAC name: [1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]boronic acid. InChIKey: UAGJZZDMFOTJRN-UHFFFAOYSA-N.
| Molecular formula | C13H16BNO4 |
|---|---|
| Molecular weight | 261.08 g/mol |
| IUPAC name | [1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]boronic acid |
| InChIKey | UAGJZZDMFOTJRN-UHFFFAOYSA-N |
| SMILES | B(C1=CN(C2=CC=CC=C12)C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)